C37H62O5 — CID 168962192
bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate (PubChem CID 168962192) has the molecular formula C37H62O5 and a molecular weight of 586.90 g/mol. Its IUPAC name is bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate.
| Compound Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate |
|---|---|
| PubChem CID | 168962192 |
| Molecular Formula | C37H62O5 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.46 |
| IUPAC Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](OC(=O)CCCCCCCC(=O)CCCCCCCC(=O)O[C@@H]1C[C@@H]3CC[C@@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C37H62O5/c1-34(2)27-21-23-36(34,5)30(25-27)41-32(39)19-15-11-7-9-13-17-29(38)18-14-10-8-12-16-20-33(40)42-31-26-28-22-24-37(31,6)35(28,3)4/h27-28,30-31H,7-26H2,1-6H3/t27-,28-,30+,31+,36+,37+/m0/s1 |
| InChIKey | BYBXMSPSZFNFFN-GBLNKFBTSA-N |
| XLogP | 9.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|