C40H72O5 — CID 170937807
1-O-(3-pentyloctyl) 17-O-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate (PubChem CID 170937807) has the molecular formula C40H72O5 and a molecular weight of 633.01 g/mol. Its IUPAC name is 1-O-(3-pentyloctyl) 17-O-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate.
| Compound Name | 1-O-(3-pentyloctyl) 17-O-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate |
|---|---|
| PubChem CID | 170937807 |
| Molecular Formula | C40H72O5 |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.54 |
| IUPAC Name | 1-O-(3-pentyloctyl) 17-O-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9-oxoheptadecanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(=O)CCCCCCCC(=O)OC1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C40H72O5/c1-6-8-16-22-33(23-17-9-7-2)29-31-44-37(42)26-20-14-10-12-18-24-35(41)25-19-13-11-15-21-27-38(43)45-36-32-34-28-30-40(36,5)39(34,3)4/h33-34,36H,6-32H2,1-5H3/t34-,36?,40+/m1/s1 |
| InChIKey | PGHYKLMLAKMCDP-GJRRFENLSA-N |
| XLogP | 11.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|