About 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate
1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate (PubChem CID 168962274) has the molecular formula C36H64O5
and a molecular weight of 576.90 g/mol. Its IUPAC name is 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate |
| PubChem CID | 168962274 |
| Molecular Formula | C36H64O5 |
| Molecular Weight | 576.90 g/mol |
| Exact Mass | 576.48 |
| IUPAC Name | 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(=O)CCCC(=O)OCCC12CCC(CC1)CC2 |
| InChI | InChI=1S/C36H64O5/c1-3-5-10-15-31(16-11-6-4-2)24-29-40-34(38)19-13-9-7-8-12-17-33(37)18-14-20-35(39)41-30-28-36-25-21-32(22-26-36)23-27-36/h31-32H,3-30H2,1-2H3 |
| InChIKey | DYMRUCCCSASJMD-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.90 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate?
The IUPAC name of 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate (CID 168962274) is 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate.
What is the SMILES notation for 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate?
The canonical SMILES for 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate is CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(=O)CCCC(=O)OCCC12CCC(CC1)CC2.
What is the InChIKey of 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate?
The InChIKey is DYMRUCCCSASJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H64O5/c1-3-5-10-15-31(16-11-6-4-2)24-29-40-34(38)19-13-9-7-8-12-17-33(37)18-14-20-35(39)41-30-28-36-25-21-32(22-26-36)23-27-36/h31-32H,3-30H2,1-2H3.
What are the key properties of 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate?
1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate has a molecular weight of 576.90 g/mol, XLogP of 10.07, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(1-bicyclo[2.2.2]octanyl)ethyl] 13-O-(3-pentyloctyl) 5-oxotridecanedioate is sourced from PubChem (CID 168962274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).