About 3-heptyldecyl 8-aminooctanoate
3-heptyldecyl 8-aminooctanoate (PubChem CID 169107618) has the molecular formula C25H51NO2
and a molecular weight of 397.69 g/mol. Its IUPAC name is 3-heptyldecyl 8-aminooctanoate.
Molecular Properties
| Compound Name | 3-heptyldecyl 8-aminooctanoate |
| PubChem CID | 169107618 |
| Molecular Formula | C25H51NO2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.39 |
| IUPAC Name | 3-heptyldecyl 8-aminooctanoate |
| SMILES | CCCCCCCC(CCCCCCC)CCOC(=O)CCCCCCCN |
| InChI | InChI=1S/C25H51NO2/c1-3-5-7-10-14-18-24(19-15-11-8-6-4-2)21-23-28-25(27)20-16-12-9-13-17-22-26/h24H,3-23,26H2,1-2H3 |
| InChIKey | FTKRCXDAQUKAOH-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-heptyldecyl 8-aminooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptyldecyl 8-aminooctanoate?
The IUPAC name of 3-heptyldecyl 8-aminooctanoate (CID 169107618) is 3-heptyldecyl 8-aminooctanoate.
What is the SMILES notation for 3-heptyldecyl 8-aminooctanoate?
The canonical SMILES for 3-heptyldecyl 8-aminooctanoate is CCCCCCCC(CCCCCCC)CCOC(=O)CCCCCCCN.
What is the InChIKey of 3-heptyldecyl 8-aminooctanoate?
The InChIKey is FTKRCXDAQUKAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H51NO2/c1-3-5-7-10-14-18-24(19-15-11-8-6-4-2)21-23-28-25(27)20-16-12-9-13-17-22-26/h24H,3-23,26H2,1-2H3.
What are the key properties of 3-heptyldecyl 8-aminooctanoate?
3-heptyldecyl 8-aminooctanoate has a molecular weight of 397.69 g/mol, XLogP of 7.56, 22 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptyldecyl 8-aminooctanoate is sourced from PubChem (CID 169107618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).