About 4-aminobutyl decanoate
4-aminobutyl decanoate (PubChem CID 57039982) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-aminobutyl decanoate.
Molecular Properties
| Compound Name | 4-aminobutyl decanoate |
| PubChem CID | 57039982 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 4-aminobutyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCCN |
| InChI | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-11-14(16)17-13-10-9-12-15/h2-13,15H2,1H3 |
| InChIKey | YRQLZIHSAQYSRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl decanoate?
The IUPAC name of 4-aminobutyl decanoate (CID 57039982) is 4-aminobutyl decanoate.
What is the SMILES notation for 4-aminobutyl decanoate?
The canonical SMILES for 4-aminobutyl decanoate is CCCCCCCCCC(=O)OCCCCN.
What is the InChIKey of 4-aminobutyl decanoate?
The InChIKey is YRQLZIHSAQYSRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-11-14(16)17-13-10-9-12-15/h2-13,15H2,1H3.
What are the key properties of 4-aminobutyl decanoate?
4-aminobutyl decanoate has a molecular weight of 243.39 g/mol, XLogP of 3.41, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl decanoate is sourced from PubChem (CID 57039982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).