About butyl 7-aminoheptanoate
butyl 7-aminoheptanoate (PubChem CID 20502898) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is butyl 7-aminoheptanoate.
Molecular Properties
| Compound Name | butyl 7-aminoheptanoate |
| PubChem CID | 20502898 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | butyl 7-aminoheptanoate |
| SMILES | CCCCOC(=O)CCCCCCN |
| InChI | InChI=1S/C11H23NO2/c1-2-3-10-14-11(13)8-6-4-5-7-9-12/h2-10,12H2,1H3 |
| InChIKey | FDMSFJJPLJBLCZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 7-aminoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 7-aminoheptanoate?
The IUPAC name of butyl 7-aminoheptanoate (CID 20502898) is butyl 7-aminoheptanoate.
What is the SMILES notation for butyl 7-aminoheptanoate?
The canonical SMILES for butyl 7-aminoheptanoate is CCCCOC(=O)CCCCCCN.
What is the InChIKey of butyl 7-aminoheptanoate?
The InChIKey is FDMSFJJPLJBLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-2-3-10-14-11(13)8-6-4-5-7-9-12/h2-10,12H2,1H3.
What are the key properties of butyl 7-aminoheptanoate?
butyl 7-aminoheptanoate has a molecular weight of 201.31 g/mol, XLogP of 2.24, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 7-aminoheptanoate is sourced from PubChem (CID 20502898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).