C45H76N2O4S — CID 168962290
3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-[3-(1,3-thiazol-2-yl)prop-2-ynyl]amino]octanoate (PubChem CID 168962290) has the molecular formula C45H76N2O4S and a molecular weight of 741.18 g/mol. Its IUPAC name is 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-[3-(1,3-thiazol-2-yl)prop-2-ynyl]amino]octanoate.
| Compound Name | 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-[3-(1,3-thiazol-2-yl)prop-2-ynyl]amino]octanoate |
|---|---|
| PubChem CID | 168962290 |
| Molecular Formula | C45H76N2O4S |
| Molecular Weight | 741.18 g/mol |
| Exact Mass | 740.55 |
| IUPAC Name | 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-[3-(1,3-thiazol-2-yl)prop-2-ynyl]amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCN(CC#Cc1nccs1)CCCCCCCC(=O)OCCC12CCC(CC1)CC2 |
| InChI | InChI=1S/C45H76N2O4S/c1-3-5-13-20-40(21-14-6-4-2)28-37-50-43(48)23-15-9-7-11-17-34-47(36-19-22-42-46-33-39-52-42)35-18-12-8-10-16-24-44(49)51-38-32-45-29-25-41(26-30-45)27-31-45/h33,39-41H,3-18,20-21,23-32,34-38H2,1-2H3 |
| InChIKey | UVZXSEGNDZGQNX-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.18 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|