C46H85N3O4 — CID 174194077
3-hexylnonyl 8-[[8-(1-bicyclo[2.2.2]octanylmethoxy)-8-hydroxyoctyl]-(3-imidazol-1-ylpropyl)amino]octanoate (PubChem CID 174194077) has the molecular formula C46H85N3O4 and a molecular weight of 744.20 g/mol. Its IUPAC name is 3-hexylnonyl 8-[[8-(1-bicyclo[2.2.2]octanylmethoxy)-8-hydroxyoctyl]-(3-imidazol-1-ylpropyl)amino]octanoate.
| Compound Name | 3-hexylnonyl 8-[[8-(1-bicyclo[2.2.2]octanylmethoxy)-8-hydroxyoctyl]-(3-imidazol-1-ylpropyl)amino]octanoate |
|---|---|
| PubChem CID | 174194077 |
| Molecular Formula | C46H85N3O4 |
| Molecular Weight | 744.20 g/mol |
| Exact Mass | 743.65 |
| IUPAC Name | 3-hexylnonyl 8-[[8-(1-bicyclo[2.2.2]octanylmethoxy)-8-hydroxyoctyl]-(3-imidazol-1-ylpropyl)amino]octanoate |
| SMILES | CCCCCCC(CCCCCC)CCOC(=O)CCCCCCCN(CCCCCCCC(O)OCC12CCC(CC1)CC2)CCCn1ccnc1 |
| InChI | InChI=1S/C46H85N3O4/c1-3-5-7-15-22-42(23-16-8-6-4-2)29-39-52-44(50)24-17-11-9-13-19-34-48(36-21-37-49-38-33-47-41-49)35-20-14-10-12-18-25-45(51)53-40-46-30-26-43(27-31-46)28-32-46/h33,38,41-43,45,51H,3-32,34-37,39-40H2,1-2H3 |
| InChIKey | BISBBFZKRBMAAZ-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.20 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|