C52H99N3O4 — CID 171658814
2-butyldecyl 8-[[8-(2-butyldecoxy)-7-methyl-8-oxooctyl]-(3-imidazol-1-ylpropyl)amino]-2-methyloctanoate (PubChem CID 171658814) has the molecular formula C52H99N3O4 and a molecular weight of 830.38 g/mol. Its IUPAC name is 2-butyldecyl 8-[[8-(2-butyldecoxy)-7-methyl-8-oxooctyl]-(3-imidazol-1-ylpropyl)amino]-2-methyloctanoate.
| Compound Name | 2-butyldecyl 8-[[8-(2-butyldecoxy)-7-methyl-8-oxooctyl]-(3-imidazol-1-ylpropyl)amino]-2-methyloctanoate |
|---|---|
| PubChem CID | 171658814 |
| Molecular Formula | C52H99N3O4 |
| Molecular Weight | 830.38 g/mol |
| Exact Mass | 829.76 |
| IUPAC Name | 2-butyldecyl 8-[[8-(2-butyldecoxy)-7-methyl-8-oxooctyl]-(3-imidazol-1-ylpropyl)amino]-2-methyloctanoate |
| SMILES | CCCCCCCCC(CCCC)COC(=O)C(C)CCCCCCN(CCCCCCC(C)C(=O)OCC(CCCC)CCCCCCCC)CCCn1ccnc1 |
| InChI | InChI=1S/C52H99N3O4/c1-7-11-15-17-19-27-36-49(34-13-9-3)44-58-51(56)47(5)32-25-21-23-29-39-54(41-31-42-55-43-38-53-46-55)40-30-24-22-26-33-48(6)52(57)59-45-50(35-14-10-4)37-28-20-18-16-12-8-2/h38,43,46-50H,7-37,39-42,44-45H2,1-6H3 |
| InChIKey | CFFQZRUGTCJOLI-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.38 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|