C57H109N3O5 — CID 176870457
heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-imidazol-1-ylbutyl)amino]-5-hydroxyoctanoate (PubChem CID 176870457) has the molecular formula C57H109N3O5 and a molecular weight of 916.51 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-imidazol-1-ylbutyl)amino]-5-hydroxyoctanoate.
| Compound Name | heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-imidazol-1-ylbutyl)amino]-5-hydroxyoctanoate |
|---|---|
| PubChem CID | 176870457 |
| Molecular Formula | C57H109N3O5 |
| Molecular Weight | 916.51 g/mol |
| Exact Mass | 915.84 |
| IUPAC Name | heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-imidazol-1-ylbutyl)amino]-5-hydroxyoctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCn1ccnc1)CCCC(O)CCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C57H109N3O5/c1-5-9-13-17-22-28-40-54(41-29-23-18-14-10-6-2)64-56(62)44-32-26-21-27-33-47-59(48-34-35-49-60-51-46-58-52-60)50-37-39-53(61)38-36-45-57(63)65-55(42-30-24-19-15-11-7-3)43-31-25-20-16-12-8-4/h46,51-55,61H,5-45,47-50H2,1-4H3 |
| InChIKey | YJAIQDRMAAKGMK-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.51 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|