About [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate
[(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate (PubChem CID 142378810) has the molecular formula C39H79NO3
and a molecular weight of 610.07 g/mol. Its IUPAC name is [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate.
Molecular Properties
| Compound Name | [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate |
| PubChem CID | 142378810 |
| Molecular Formula | C39H79NO3 |
| Molecular Weight | 610.07 g/mol |
| Exact Mass | 609.61 |
| IUPAC Name | [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate |
| SMILES | CCCCCCCCCC[C@H](O)CCCN(C)CCCCCCCC(=O)O[C@@H](CCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C39H79NO3/c1-5-8-11-14-16-17-20-24-30-37(41)31-29-36-40(4)35-28-23-18-22-27-34-39(42)43-38(32-25-19-13-10-7-3)33-26-21-15-12-9-6-2/h37-38,41H,5-36H2,1-4H3/t37-,38-/m0/s1 |
| InChIKey | GEBDQEUNXLAOMS-UWXQCODUSA-N |
| XLogP | 11.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.07 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate?
The IUPAC name of [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate (CID 142378810) is [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate.
What is the SMILES notation for [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate?
The canonical SMILES for [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate is CCCCCCCCCC[C@H](O)CCCN(C)CCCCCCCC(=O)O[C@@H](CCCCCCC)CCCCCCCC.
What is the InChIKey of [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate?
The InChIKey is GEBDQEUNXLAOMS-UWXQCODUSA-N. The full InChI is InChI=1S/C39H79NO3/c1-5-8-11-14-16-17-20-24-30-37(41)31-29-36-40(4)35-28-23-18-22-27-34-39(42)43-38(32-25-19-13-10-7-3)33-26-21-15-12-9-6-2/h37-38,41H,5-36H2,1-4H3/t37-,38-/m0/s1.
What are the key properties of [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate?
[(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate has a molecular weight of 610.07 g/mol, XLogP of 11.95, 35 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(8S)-hexadecan-8-yl] 8-[[(4S)-4-hydroxytetradecyl]-methylamino]octanoate is sourced from PubChem (CID 142378810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).