About dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate
dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate (PubChem CID 155720156) has the molecular formula C45H89NO4
and a molecular weight of 708.21 g/mol. Its IUPAC name is dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate.
Molecular Properties
| Compound Name | dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate |
| PubChem CID | 155720156 |
| Molecular Formula | C45H89NO4 |
| Molecular Weight | 708.21 g/mol |
| Exact Mass | 707.68 |
| IUPAC Name | dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(C)CCCCCCCC(=O)OC(CCCCC)CCCCCC |
| InChI | InChI=1S/C45H89NO4/c1-6-10-14-17-21-29-37-43(36-28-20-15-11-7-2)50-45(48)39-31-23-19-25-33-41-46(5)40-32-24-18-22-30-38-44(47)49-42(34-26-13-9-4)35-27-16-12-8-3/h42-43H,6-41H2,1-5H3 |
| InChIKey | ILCWCFQKUFNVLA-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 708.21 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate?
The IUPAC name of dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate (CID 155720156) is dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate.
What is the SMILES notation for dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate?
The canonical SMILES for dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate is CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(C)CCCCCCCC(=O)OC(CCCCC)CCCCCC.
What is the InChIKey of dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate?
The InChIKey is ILCWCFQKUFNVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H89NO4/c1-6-10-14-17-21-29-37-43(36-28-20-15-11-7-2)50-45(48)39-31-23-19-25-33-41-46(5)40-32-24-18-22-30-38-44(47)49-42(34-26-13-9-4)35-27-16-12-8-3/h42-43H,6-41H2,1-5H3.
What are the key properties of dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate?
dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate has a molecular weight of 708.21 g/mol, XLogP of 14.08, 40 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-6-yl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-methylamino]octanoate is sourced from PubChem (CID 155720156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).