C38H78N2O3 — CID 170968505
heptadecan-9-yl 8-[2-[2-hydroxyethyl(methyl)amino]ethyl-octylamino]octanoate (PubChem CID 170968505) has the molecular formula C38H78N2O3 and a molecular weight of 611.05 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-[2-hydroxyethyl(methyl)amino]ethyl-octylamino]octanoate.
| Compound Name | heptadecan-9-yl 8-[2-[2-hydroxyethyl(methyl)amino]ethyl-octylamino]octanoate |
|---|---|
| PubChem CID | 170968505 |
| Molecular Formula | C38H78N2O3 |
| Molecular Weight | 611.05 g/mol |
| Exact Mass | 610.60 |
| IUPAC Name | heptadecan-9-yl 8-[2-[2-hydroxyethyl(methyl)amino]ethyl-octylamino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC)CCN(C)CCO |
| InChI | InChI=1S/C38H78N2O3/c1-5-8-11-14-18-23-28-37(29-24-19-15-12-9-6-2)43-38(42)30-25-20-17-22-27-32-40(34-33-39(4)35-36-41)31-26-21-16-13-10-7-3/h37,41H,5-36H2,1-4H3 |
| InChIKey | DPYHSSUWNIBIOG-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.05 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|