About decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate
decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate (PubChem CID 166162399) has the molecular formula C27H55NO3
and a molecular weight of 441.74 g/mol. Its IUPAC name is decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate.
Molecular Properties
| Compound Name | decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate |
| PubChem CID | 166162399 |
| Molecular Formula | C27H55NO3 |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 441.42 |
| IUPAC Name | decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCC)CCCCC |
| InChI | InChI=1S/C27H55NO3/c1-4-7-10-13-17-22-28(24-25-29)23-18-14-11-12-16-21-27(30)31-26(19-9-6-3)20-15-8-5-2/h26,29H,4-25H2,1-3H3 |
| InChIKey | YGARHGMLQCHGIL-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate?
The IUPAC name of decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate (CID 166162399) is decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate.
What is the SMILES notation for decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate?
The canonical SMILES for decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate is CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCC)CCCCC.
What is the InChIKey of decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate?
The InChIKey is YGARHGMLQCHGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H55NO3/c1-4-7-10-13-17-22-28(24-25-29)23-18-14-11-12-16-21-27(30)31-26(19-9-6-3)20-15-8-5-2/h26,29H,4-25H2,1-3H3.
What are the key properties of decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate?
decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate has a molecular weight of 441.74 g/mol, XLogP of 7.27, 24 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decan-5-yl 8-[heptyl(2-hydroxyethyl)amino]octanoate is sourced from PubChem (CID 166162399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).