About undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate
undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate (PubChem CID 167389138) has the molecular formula C42H83NO5
and a molecular weight of 682.13 g/mol. Its IUPAC name is undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate.
Molecular Properties
| Compound Name | undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate |
| PubChem CID | 167389138 |
| Molecular Formula | C42H83NO5 |
| Molecular Weight | 682.13 g/mol |
| Exact Mass | 681.63 |
| IUPAC Name | undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCO)CCCCCC(=O)OC(CCC)CCCCCCC |
| InChI | InChI=1S/C42H83NO5/c1-5-9-12-15-18-23-31-40(32-24-19-16-13-10-6-2)48-42(46)34-26-21-28-36-43(37-38-44)35-27-20-25-33-41(45)47-39(29-8-4)30-22-17-14-11-7-3/h39-40,44H,5-38H2,1-4H3 |
| InChIKey | LCVWPOOZKQISND-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.13 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate?
The IUPAC name of undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate (CID 167389138) is undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate.
What is the SMILES notation for undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate?
The canonical SMILES for undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate is CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCO)CCCCCC(=O)OC(CCC)CCCCCCC.
What is the InChIKey of undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate?
The InChIKey is LCVWPOOZKQISND-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H83NO5/c1-5-9-12-15-18-23-31-40(32-24-19-16-13-10-6-2)48-42(46)34-26-21-28-36-43(37-38-44)35-27-20-25-33-41(45)47-39(29-8-4)30-22-17-14-11-7-3/h39-40,44H,5-38H2,1-4H3.
What are the key properties of undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate?
undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate has a molecular weight of 682.13 g/mol, XLogP of 11.89, 38 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]hexanoate is sourced from PubChem (CID 167389138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).