About dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate
dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate (PubChem CID 142431584) has the molecular formula C44H87NO4
and a molecular weight of 694.18 g/mol. Its IUPAC name is dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate.
Molecular Properties
| Compound Name | dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate |
| PubChem CID | 142431584 |
| Molecular Formula | C44H87NO4 |
| Molecular Weight | 694.18 g/mol |
| Exact Mass | 693.66 |
| IUPAC Name | dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate |
| SMILES | CCCCCCCCC(CCC)OC(=O)CCCCCN(CCC)CCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C44H87NO4/c1-6-11-14-17-20-25-33-41(32-9-4)48-43(46)36-28-23-30-39-45(38-10-5)40-31-24-29-37-44(47)49-42(34-26-21-18-15-12-7-2)35-27-22-19-16-13-8-3/h41-42H,6-40H2,1-5H3 |
| InChIKey | NZXRUBMAAFUCPE-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.18 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate?
The IUPAC name of dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate (CID 142431584) is dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate.
What is the SMILES notation for dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate?
The canonical SMILES for dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate is CCCCCCCCC(CCC)OC(=O)CCCCCN(CCC)CCCCCC(=O)OC(CCCCCCCC)CCCCCCCC.
What is the InChIKey of dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate?
The InChIKey is NZXRUBMAAFUCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H87NO4/c1-6-11-14-17-20-25-33-41(32-9-4)48-43(46)36-28-23-30-39-45(38-10-5)40-31-24-29-37-44(47)49-42(34-26-21-18-15-12-7-2)35-27-22-19-16-13-8-3/h41-42H,6-40H2,1-5H3.
What are the key properties of dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate?
dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate has a molecular weight of 694.18 g/mol, XLogP of 13.69, 39 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-4-yl 6-[(6-heptadecan-9-yloxy-6-oxohexyl)-propylamino]hexanoate is sourced from PubChem (CID 142431584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).