About octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate
octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate (PubChem CID 166072894) has the molecular formula C34H69NO3
and a molecular weight of 539.93 g/mol. Its IUPAC name is octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate.
Molecular Properties
| Compound Name | octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate |
| PubChem CID | 166072894 |
| Molecular Formula | C34H69NO3 |
| Molecular Weight | 539.93 g/mol |
| Exact Mass | 539.53 |
| IUPAC Name | octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCCN(CCO)CCCCC |
| InChI | InChI=1S/C34H69NO3/c1-4-7-10-12-14-18-22-27-33(26-21-17-13-11-8-5-2)38-34(37)28-23-19-15-16-20-25-30-35(31-32-36)29-24-9-6-3/h33,36H,4-32H2,1-3H3 |
| InChIKey | AMNWTSARYROWCM-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.93 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate?
The IUPAC name of octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate (CID 166072894) is octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate.
What is the SMILES notation for octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate?
The canonical SMILES for octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate is CCCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCCN(CCO)CCCCC.
What is the InChIKey of octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate?
The InChIKey is AMNWTSARYROWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H69NO3/c1-4-7-10-12-14-18-22-27-33(26-21-17-13-11-8-5-2)38-34(37)28-23-19-15-16-20-25-30-35(31-32-36)29-24-9-6-3/h33,36H,4-32H2,1-3H3.
What are the key properties of octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate?
octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate has a molecular weight of 539.93 g/mol, XLogP of 10.00, 31 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octadecan-9-yl 9-[2-hydroxyethyl(pentyl)amino]nonanoate is sourced from PubChem (CID 166072894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).