About heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate
heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate (PubChem CID 155275722) has the molecular formula C44H87NO5
and a molecular weight of 710.18 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate.
Molecular Properties
| Compound Name | heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate |
| PubChem CID | 155275722 |
| Molecular Formula | C44H87NO5 |
| Molecular Weight | 710.18 g/mol |
| Exact Mass | 709.66 |
| IUPAC Name | heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(C)OC(=O)CCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C44H87NO5/c1-5-8-11-14-18-25-32-41(4)49-43(47)35-29-22-24-31-38-45(39-40-46)37-30-23-17-21-28-36-44(48)50-42(33-26-19-15-12-9-6-2)34-27-20-16-13-10-7-3/h41-42,46H,5-40H2,1-4H3 |
| InChIKey | MFBYZLXKEIWOPG-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.18 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate?
The IUPAC name of heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate (CID 155275722) is heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate.
What is the SMILES notation for heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate?
The canonical SMILES for heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate is CCCCCCCCC(C)OC(=O)CCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC.
What is the InChIKey of heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate?
The InChIKey is MFBYZLXKEIWOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H87NO5/c1-5-8-11-14-18-25-32-41(4)49-43(47)35-29-22-24-31-38-45(39-40-46)37-30-23-17-21-28-36-44(48)50-42(33-26-19-15-12-9-6-2)34-27-20-16-13-10-7-3/h41-42,46H,5-40H2,1-4H3.
What are the key properties of heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate?
heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate has a molecular weight of 710.18 g/mol, XLogP of 12.67, 40 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-9-yl 8-[(7-decan-2-yloxy-7-oxoheptyl)-(2-hydroxyethyl)amino]octanoate is sourced from PubChem (CID 155275722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).