About hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate
hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate (PubChem CID 155719917) has the molecular formula C30H61NO3
and a molecular weight of 483.82 g/mol. Its IUPAC name is hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate.
Molecular Properties
| Compound Name | hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate |
| PubChem CID | 155719917 |
| Molecular Formula | C30H61NO3 |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 483.47 |
| IUPAC Name | hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCCCN(CCO)CCCCCC |
| InChI | InChI=1S/C30H61NO3/c1-4-7-10-13-15-18-23-29(22-17-14-11-8-5-2)34-30(33)24-19-16-21-26-31(27-28-32)25-20-12-9-6-3/h29,32H,4-28H2,1-3H3 |
| InChIKey | MTOSWRZKHULEEJ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate?
The IUPAC name of hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate (CID 155719917) is hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate.
What is the SMILES notation for hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate?
The canonical SMILES for hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate is CCCCCCCCC(CCCCCCC)OC(=O)CCCCCN(CCO)CCCCCC.
What is the InChIKey of hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate?
The InChIKey is MTOSWRZKHULEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H61NO3/c1-4-7-10-13-15-18-23-29(22-17-14-11-8-5-2)34-30(33)24-19-16-21-26-31(27-28-32)25-20-12-9-6-3/h29,32H,4-28H2,1-3H3.
What are the key properties of hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate?
hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate has a molecular weight of 483.82 g/mol, XLogP of 8.44, 27 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-8-yl 6-[hexyl(2-hydroxyethyl)amino]hexanoate is sourced from PubChem (CID 155719917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).