C48H96N2O6 — CID 126717402
nonyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate (PubChem CID 126717402) has the molecular formula C48H96N2O6 and a molecular weight of 797.30 g/mol. Its IUPAC name is nonyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate.
| Compound Name | nonyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 126717402 |
| Molecular Formula | C48H96N2O6 |
| Molecular Weight | 797.30 g/mol |
| Exact Mass | 796.73 |
| IUPAC Name | nonyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H96N2O6/c1-4-7-10-13-16-25-32-45-55-47(53)35-28-21-17-23-30-37-49(41-43-51)39-40-50(42-44-52)38-31-24-18-22-29-36-48(54)56-46(33-26-19-14-11-8-5-2)34-27-20-15-12-9-6-3/h46,51-52H,4-45H2,1-3H3 |
| InChIKey | XZHXGCBHPOIKBU-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.30 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|