C40H79NO5 — CID 155278365
heptyl 8-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]octanoate (PubChem CID 155278365) has the molecular formula C40H79NO5 and a molecular weight of 654.07 g/mol. Its IUPAC name is heptyl 8-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]octanoate.
| Compound Name | heptyl 8-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 155278365 |
| Molecular Formula | C40H79NO5 |
| Molecular Weight | 654.07 g/mol |
| Exact Mass | 653.60 |
| IUPAC Name | heptyl 8-[(6-heptadecan-9-yloxy-6-oxohexyl)-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCN(CCO)CCCCCCCC(=O)OCCCCCCC |
| InChI | InChI=1S/C40H79NO5/c1-4-7-10-13-16-22-29-38(30-23-17-14-11-8-5-2)46-40(44)32-25-21-27-34-41(35-36-42)33-26-19-15-18-24-31-39(43)45-37-28-20-12-9-6-3/h38,42H,4-37H2,1-3H3 |
| InChIKey | OBICQCJSBKRQKD-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.07 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|