C37H73NO5 — CID 171836806
pentyl 9-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]nonanoate (PubChem CID 171836806) has the molecular formula C37H73NO5 and a molecular weight of 611.99 g/mol. Its IUPAC name is pentyl 9-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]nonanoate.
| Compound Name | pentyl 9-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]nonanoate |
|---|---|
| PubChem CID | 171836806 |
| Molecular Formula | C37H73NO5 |
| Molecular Weight | 611.99 g/mol |
| Exact Mass | 611.55 |
| IUPAC Name | pentyl 9-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]nonanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCN(CCO)CCCCCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C37H73NO5/c1-4-7-10-12-16-20-26-35(27-21-17-13-11-8-5-2)43-37(41)29-25-31-38(32-33-39)30-23-19-15-14-18-22-28-36(40)42-34-24-9-6-3/h35,39H,4-34H2,1-3H3 |
| InChIKey | ONXBKTZWGKQJET-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.99 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|