C36H71NO5 — CID 167362028
nonyl 4-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]butanoate (PubChem CID 167362028) has the molecular formula C36H71NO5 and a molecular weight of 597.97 g/mol. Its IUPAC name is nonyl 4-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]butanoate.
| Compound Name | nonyl 4-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]butanoate |
|---|---|
| PubChem CID | 167362028 |
| Molecular Formula | C36H71NO5 |
| Molecular Weight | 597.97 g/mol |
| Exact Mass | 597.53 |
| IUPAC Name | nonyl 4-[(4-heptadecan-9-yloxy-4-oxobutyl)-(2-hydroxyethyl)amino]butanoate |
| SMILES | CCCCCCCCCOC(=O)CCCN(CCO)CCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C36H71NO5/c1-4-7-10-13-16-19-22-33-41-35(39)27-23-29-37(31-32-38)30-24-28-36(40)42-34(25-20-17-14-11-8-5-2)26-21-18-15-12-9-6-3/h34,38H,4-33H2,1-3H3 |
| InChIKey | ZDYMKAHIQLANJU-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.97 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|