C44H88N2O6 — CID 167418904
pentyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate (PubChem CID 167418904) has the molecular formula C44H88N2O6 and a molecular weight of 741.20 g/mol. Its IUPAC name is pentyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate.
| Compound Name | pentyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 167418904 |
| Molecular Formula | C44H88N2O6 |
| Molecular Weight | 741.20 g/mol |
| Exact Mass | 740.66 |
| IUPAC Name | pentyl 8-[2-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCN(CCO)CCCCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C44H88N2O6/c1-4-7-10-12-16-22-29-42(30-23-17-13-11-8-5-2)52-44(50)32-25-19-15-21-27-34-46(38-40-48)36-35-45(37-39-47)33-26-20-14-18-24-31-43(49)51-41-28-9-6-3/h42,47-48H,4-41H2,1-3H3 |
| InChIKey | ADDHZDOEZDCYDF-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.20 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|