C96H182N6O8 — CID 167712122
7-[3-imidazol-1-ylpropyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate (PubChem CID 167712122) has the molecular formula C96H182N6O8 and a molecular weight of 1548.55 g/mol. Its IUPAC name is 7-[3-imidazol-1-ylpropyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate.
| Compound Name | 7-[3-imidazol-1-ylpropyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate |
|---|---|
| PubChem CID | 167712122 |
| Molecular Formula | C96H182N6O8 |
| Molecular Weight | 1548.55 g/mol |
| Exact Mass | 1547.40 |
| IUPAC Name | 7-[3-imidazol-1-ylpropyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC)CCCn1ccnc1.CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC)CCCn1ccnc1 |
| InChI | InChI=1S/2C48H91N3O4/c2*1-4-7-10-13-16-24-31-43-54-47(52)36-28-21-17-22-29-38-50(40-33-41-51-42-37-49-45-51)39-30-23-18-25-32-44-55-48(53)46(34-26-19-14-11-8-5-2)35-27-20-15-12-9-6-3/h2*37,42,45-46H,4-36,38-41,43-44H2,1-3H3 |
| InChIKey | ZZPPVNAUGDDXTJ-UHFFFAOYSA-N |
| XLogP | 27.64 |
| TPSA | 147.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 86 |
| Heavy Atoms | 110 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1548.55 |
| LogP ≤ 5 | 27.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|