C46H87N3O4 — CID 169079667
7-[(8-heptoxy-8-oxooctyl)-(3-imidazol-1-ylpropyl)amino]heptyl 2-octyldecanoate (PubChem CID 169079667) has the molecular formula C46H87N3O4 and a molecular weight of 746.22 g/mol. Its IUPAC name is 7-[(8-heptoxy-8-oxooctyl)-(3-imidazol-1-ylpropyl)amino]heptyl 2-octyldecanoate.
| Compound Name | 7-[(8-heptoxy-8-oxooctyl)-(3-imidazol-1-ylpropyl)amino]heptyl 2-octyldecanoate |
|---|---|
| PubChem CID | 169079667 |
| Molecular Formula | C46H87N3O4 |
| Molecular Weight | 746.22 g/mol |
| Exact Mass | 745.67 |
| IUPAC Name | 7-[(8-heptoxy-8-oxooctyl)-(3-imidazol-1-ylpropyl)amino]heptyl 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OCCCCCCCN(CCCCCCCC(=O)OCCCCCCC)CCCn1ccnc1 |
| InChI | InChI=1S/C46H87N3O4/c1-4-7-10-13-17-24-32-44(33-25-18-14-11-8-5-2)46(51)53-42-30-23-16-21-28-37-48(38-31-39-49-40-35-47-43-49)36-27-20-15-19-26-34-45(50)52-41-29-22-12-9-6-3/h35,40,43-44H,4-34,36-39,41-42H2,1-3H3 |
| InChIKey | QMTYWDLHZRVRFX-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.22 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|