C36H71N3O2 — CID 178033511
ethane;3-pentyloctyl 8-[heptyl(3-imidazol-1-ylpropyl)amino]octanoate (PubChem CID 178033511) has the molecular formula C36H71N3O2 and a molecular weight of 577.98 g/mol. Its IUPAC name is ethane;3-pentyloctyl 8-[heptyl(3-imidazol-1-ylpropyl)amino]octanoate.
| Compound Name | ethane;3-pentyloctyl 8-[heptyl(3-imidazol-1-ylpropyl)amino]octanoate |
|---|---|
| PubChem CID | 178033511 |
| Molecular Formula | C36H71N3O2 |
| Molecular Weight | 577.98 g/mol |
| Exact Mass | 577.55 |
| IUPAC Name | ethane;3-pentyloctyl 8-[heptyl(3-imidazol-1-ylpropyl)amino]octanoate |
| SMILES | CC.CCCCCCCN(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)CCCn1ccnc1 |
| InChI | InChI=1S/C34H65N3O2.C2H6/c1-4-7-10-13-18-26-36(28-20-29-37-30-25-35-32-37)27-19-14-11-12-17-23-34(38)39-31-24-33(21-15-8-5-2)22-16-9-6-3;1-2/h25,30,32-33H,4-24,26-29,31H2,1-3H3;1-2H3 |
| InChIKey | GOLFNKKKOALRMM-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.98 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|