C14H24N2O2 — CID 54366798
propyl 8-imidazol-1-yloctanoate (PubChem CID 54366798) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is propyl 8-imidazol-1-yloctanoate.
| Compound Name | propyl 8-imidazol-1-yloctanoate |
|---|---|
| PubChem CID | 54366798 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | propyl 8-imidazol-1-yloctanoate |
| SMILES | CCCOC(=O)CCCCCCCn1ccnc1 |
| InChI | InChI=1S/C14H24N2O2/c1-2-12-18-14(17)8-6-4-3-5-7-10-16-11-9-15-13-16/h9,11,13H,2-8,10,12H2,1H3 |
| InChIKey | NOWJXOLLDHSTNF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|