C38H71N3O4 — CID 165381343
6-[6-(4-ethyloctanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 4-ethyloctanoate (PubChem CID 165381343) has the molecular formula C38H71N3O4 and a molecular weight of 634.00 g/mol. Its IUPAC name is 6-[6-(4-ethyloctanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 4-ethyloctanoate.
| Compound Name | 6-[6-(4-ethyloctanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 4-ethyloctanoate |
|---|---|
| PubChem CID | 165381343 |
| Molecular Formula | C38H71N3O4 |
| Molecular Weight | 634.00 g/mol |
| Exact Mass | 633.54 |
| IUPAC Name | 6-[6-(4-ethyloctanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 4-ethyloctanoate |
| SMILES | CCCCC(CC)CCC(=O)OCCCCCCN(CCCCCCOC(=O)CCC(CC)CCCC)CCCn1ccnc1 |
| InChI | InChI=1S/C38H71N3O4/c1-5-9-20-35(7-3)22-24-37(42)44-32-17-13-11-15-27-40(29-19-30-41-31-26-39-34-41)28-16-12-14-18-33-45-38(43)25-23-36(8-4)21-10-6-2/h26,31,34-36H,5-25,27-30,32-33H2,1-4H3 |
| InChIKey | YCFQOBWCSOEQFE-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.00 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|