C42H75N3O10 — CID 176660853
2-(2-butyloctoxycarbonyloxy)ethyl 3-[[3-[2-(2-butyloctoxycarbonyloxy)ethoxy]-3-oxopropyl]-(3-imidazol-1-ylpropyl)amino]propanoate (PubChem CID 176660853) has the molecular formula C42H75N3O10 and a molecular weight of 782.07 g/mol. Its IUPAC name is 2-(2-butyloctoxycarbonyloxy)ethyl 3-[[3-[2-(2-butyloctoxycarbonyloxy)ethoxy]-3-oxopropyl]-(3-imidazol-1-ylpropyl)amino]propanoate.
| Compound Name | 2-(2-butyloctoxycarbonyloxy)ethyl 3-[[3-[2-(2-butyloctoxycarbonyloxy)ethoxy]-3-oxopropyl]-(3-imidazol-1-ylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 176660853 |
| Molecular Formula | C42H75N3O10 |
| Molecular Weight | 782.07 g/mol |
| Exact Mass | 781.55 |
| IUPAC Name | 2-(2-butyloctoxycarbonyloxy)ethyl 3-[[3-[2-(2-butyloctoxycarbonyloxy)ethoxy]-3-oxopropyl]-(3-imidazol-1-ylpropyl)amino]propanoate |
| SMILES | CCCCCCC(CCCC)COC(=O)OCCOC(=O)CCN(CCCn1ccnc1)CCC(=O)OCCOC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C42H75N3O10/c1-5-9-13-15-20-37(18-11-7-3)34-54-41(48)52-32-30-50-39(46)22-27-44(25-17-26-45-29-24-43-36-45)28-23-40(47)51-31-33-53-42(49)55-35-38(19-12-8-4)21-16-14-10-6-2/h24,29,36-38H,5-23,25-28,30-35H2,1-4H3 |
| InChIKey | GRGNSDXQTLPLEW-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 144.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.07 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|