C32H57N3O4Se2 — CID 176660867
CID 176660867 (PubChem CID 176660867) has the molecular formula C32H57N3O4Se2 and a molecular weight of 705.75 g/mol.
| Compound Name | CID 176660867 |
|---|---|
| PubChem CID | 176660867 |
| Molecular Formula | C32H57N3O4Se2 |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 707.27 |
| IUPAC Name | — |
| SMILES | CC/C=C\CCCC.CC/C=C\CCCC.O=C(CCN(CCCn1ccnc1)CCC(=O)OCC[Se])OCC[Se] |
| InChI | InChI=1S/C16H25N3O4Se2.2C8H16/c20-15(22-10-12-24)2-7-18(8-3-16(21)23-11-13-25)5-1-6-19-9-4-17-14-19;2*1-3-5-7-8-6-4-2/h4,9,14H,1-3,5-8,10-13H2;2*5,7H,3-4,6,8H2,1-2H3/b;2*7-5- |
| InChIKey | DHCGTYMWNWLPBJ-WXGYKLDASA-N |
| XLogP | 6.90 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|