C44H77N3O4 — CID 170739594
nonyl 8-[3-imidazol-1-ylpropyl-[8-[2-(3-tricyclo[4.3.1.13,8]undecanyl)acetyl]oxyoctyl]amino]octanoate (PubChem CID 170739594) has the molecular formula C44H77N3O4 and a molecular weight of 712.12 g/mol. Its IUPAC name is nonyl 8-[3-imidazol-1-ylpropyl-[8-[2-(3-tricyclo[4.3.1.13,8]undecanyl)acetyl]oxyoctyl]amino]octanoate.
| Compound Name | nonyl 8-[3-imidazol-1-ylpropyl-[8-[2-(3-tricyclo[4.3.1.13,8]undecanyl)acetyl]oxyoctyl]amino]octanoate |
|---|---|
| PubChem CID | 170739594 |
| Molecular Formula | C44H77N3O4 |
| Molecular Weight | 712.12 g/mol |
| Exact Mass | 711.59 |
| IUPAC Name | nonyl 8-[3-imidazol-1-ylpropyl-[8-[2-(3-tricyclo[4.3.1.13,8]undecanyl)acetyl]oxyoctyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCCOC(=O)CC12CCC3CC(CC(C3)C1)C2)CCCn1ccnc1 |
| InChI | InChI=1S/C44H77N3O4/c1-2-3-4-5-7-13-18-30-50-42(48)21-15-10-9-12-17-26-46(27-20-28-47-29-24-45-38-47)25-16-11-6-8-14-19-31-51-43(49)37-44-23-22-39-32-40(35-44)34-41(33-39)36-44/h24,29,38-41H,2-23,25-28,30-37H2,1H3 |
| InChIKey | SDPZJWUTDMHINA-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.12 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|