C13H23N3O3 — CID 113330780
methyl 3-[3-imidazol-1-ylpropyl(2-methoxyethyl)amino]propanoate (PubChem CID 113330780) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 3-[3-imidazol-1-ylpropyl(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[3-imidazol-1-ylpropyl(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 113330780 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | methyl 3-[3-imidazol-1-ylpropyl(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCCn1ccnc1)CCC(=O)OC |
| InChI | InChI=1S/C13H23N3O3/c1-18-11-10-15(8-4-13(17)19-2)6-3-7-16-9-5-14-12-16/h5,9,12H,3-4,6-8,10-11H2,1-2H3 |
| InChIKey | UFWFVFCPIZVIMD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |