C14H29N3O3 — CID 82892050
methyl 3-[2-methoxyethyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propanoate (PubChem CID 82892050) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is methyl 3-[2-methoxyethyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propanoate.
| Compound Name | methyl 3-[2-methoxyethyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 82892050 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | methyl 3-[2-methoxyethyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H29N3O3/c1-15-6-8-17(9-7-15)11-10-16(12-13-19-2)5-4-14(18)20-3/h4-13H2,1-3H3 |
| InChIKey | ANYDEGZBUVCQOP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |