methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate

C9H18FNO3 — CID 80601723

IUPACmethyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate
SMILESCOCCN(CCF)CCC(=O)OC
InChIInChI=1S/C9H18FNO3/c1-13-8-7-11(6-4-10)5-3-9(12)14-2/h3-8H2,1-2H3
InChIKeyHAAKJNUUXDTGCF-UHFFFAOYSA-N
MW207.24 g/mol
LogP0.47
Rot. Bonds8

About methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate

methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate (PubChem CID 80601723) has the molecular formula C9H18FNO3 and a molecular weight of 207.24 g/mol. Its IUPAC name is methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate
PubChem CID80601723
Molecular FormulaC9H18FNO3
Molecular Weight207.24 g/mol
Exact Mass207.13
IUPAC Namemethyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate
SMILESCOCCN(CCF)CCC(=O)OC
InChIInChI=1S/C9H18FNO3/c1-13-8-7-11(6-4-10)5-3-9(12)14-2/h3-8H2,1-2H3
InChIKeyHAAKJNUUXDTGCF-UHFFFAOYSA-N
XLogP0.47
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.24
LogP ≤ 50.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate?
The IUPAC name of methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate (CID 80601723) is methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate?
The canonical SMILES for methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate is COCCN(CCF)CCC(=O)OC.
What is the InChIKey of methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate?
The InChIKey is HAAKJNUUXDTGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNO3/c1-13-8-7-11(6-4-10)5-3-9(12)14-2/h3-8H2,1-2H3.
What are the key properties of methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate?
methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate has a molecular weight of 207.24 g/mol, XLogP of 0.47, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-fluoroethyl(2-methoxyethyl)amino]propanoate is sourced from PubChem (CID 80601723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).