C13H27NO3 — CID 82930234
methyl 3-[2-ethylbutyl(2-methoxyethyl)amino]propanoate (PubChem CID 82930234) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is methyl 3-[2-ethylbutyl(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[2-ethylbutyl(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 82930234 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | methyl 3-[2-ethylbutyl(2-methoxyethyl)amino]propanoate |
| SMILES | CCC(CC)CN(CCOC)CCC(=O)OC |
| InChI | InChI=1S/C13H27NO3/c1-5-12(6-2)11-14(9-10-16-3)8-7-13(15)17-4/h12H,5-11H2,1-4H3 |
| InChIKey | WYJBCDPHMBCMSG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |