methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate

C11H23NO5 — CID 115536455

IUPACmethyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate
SMILESCOCCN(CCC(=O)OC)CC(OC)OC
InChIInChI=1S/C11H23NO5/c1-14-8-7-12(6-5-10(13)15-2)9-11(16-3)17-4/h11H,5-9H2,1-4H3
InChIKeyIEOOCVTVNPIUJX-UHFFFAOYSA-N
MW249.31 g/mol
LogP0.12
Rot. Bonds10

About methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate

methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate (PubChem CID 115536455) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate
PubChem CID115536455
Molecular FormulaC11H23NO5
Molecular Weight249.31 g/mol
Exact Mass249.16
IUPAC Namemethyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate
SMILESCOCCN(CCC(=O)OC)CC(OC)OC
InChIInChI=1S/C11H23NO5/c1-14-8-7-12(6-5-10(13)15-2)9-11(16-3)17-4/h11H,5-9H2,1-4H3
InChIKeyIEOOCVTVNPIUJX-UHFFFAOYSA-N
XLogP0.12
TPSA57.23 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 50.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate?
The IUPAC name of methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate (CID 115536455) is methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate?
The canonical SMILES for methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate is COCCN(CCC(=O)OC)CC(OC)OC.
What is the InChIKey of methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate?
The InChIKey is IEOOCVTVNPIUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5/c1-14-8-7-12(6-5-10(13)15-2)9-11(16-3)17-4/h11H,5-9H2,1-4H3.
What are the key properties of methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate?
methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate has a molecular weight of 249.31 g/mol, XLogP of 0.12, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate is sourced from PubChem (CID 115536455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).