C11H23NO5 — CID 115536455
methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate (PubChem CID 115536455) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 115536455 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | methyl 3-[2,2-dimethoxyethyl(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)CC(OC)OC |
| InChI | InChI=1S/C11H23NO5/c1-14-8-7-12(6-5-10(13)15-2)9-11(16-3)17-4/h11H,5-9H2,1-4H3 |
| InChIKey | IEOOCVTVNPIUJX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|