C9H20N2O4 — CID 91137504
1-(2,2-dimethoxyethyl)-1-(2-methoxyethyl)-3-methylurea (PubChem CID 91137504) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-1-(2-methoxyethyl)-3-methylurea.
| Compound Name | 1-(2,2-dimethoxyethyl)-1-(2-methoxyethyl)-3-methylurea |
|---|---|
| PubChem CID | 91137504 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-1-(2-methoxyethyl)-3-methylurea |
| SMILES | CNC(=O)N(CCOC)CC(OC)OC |
| InChI | InChI=1S/C9H20N2O4/c1-10-9(12)11(5-6-13-2)7-8(14-3)15-4/h8H,5-7H2,1-4H3,(H,10,12) |
| InChIKey | NDKKKKLAEVAYLA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|