C9H20N2O3 — CID 108890462
3-ethyl-1,1-bis(2-methoxyethyl)urea (PubChem CID 108890462) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-ethyl-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-ethyl-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 108890462 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-ethyl-1,1-bis(2-methoxyethyl)urea |
| SMILES | CCNC(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C9H20N2O3/c1-4-10-9(12)11(5-7-13-2)6-8-14-3/h4-8H2,1-3H3,(H,10,12) |
| InChIKey | IDPZJEFLSSGYFP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |