C14H21FN2O3 — CID 44756384
3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)urea (PubChem CID 44756384) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 44756384 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)urea |
| SMILES | COCCN(CCOC)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O3/c1-19-9-7-17(8-10-20-2)14(18)16-11-12-3-5-13(15)6-4-12/h3-6H,7-11H2,1-2H3,(H,16,18) |
| InChIKey | FQLYAMFUQUSPOP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |