C12H17FN2O — CID 3851579
1,1-diethyl-3-[(4-fluorophenyl)methyl]urea (PubChem CID 3851579) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 1,1-diethyl-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1,1-diethyl-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 3851579 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1,1-diethyl-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CCN(CC)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O/c1-3-15(4-2)12(16)14-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3,(H,14,16) |
| InChIKey | LOQACNAQFXSCSL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |