C14H17FN2O — CID 108867664
3-[(4-fluorophenyl)methyl]-1,1-bis(prop-2-enyl)urea (PubChem CID 108867664) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 108867664 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O/c1-3-9-17(10-4-2)14(18)16-11-12-5-7-13(15)8-6-12/h3-8H,1-2,9-11H2,(H,16,18) |
| InChIKey | RTAJJXAPSHJVQS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|