C14H17ClN2O — CID 108897654
3-[(2-chlorophenyl)methyl]-1,1-bis(prop-2-enyl)urea (PubChem CID 108897654) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-[(2-chlorophenyl)methyl]-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 108897654 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O/c1-3-9-17(10-4-2)14(18)16-11-12-7-5-6-8-13(12)15/h3-8H,1-2,9-11H2,(H,16,18) |
| InChIKey | RTWWTZDFIKSZEH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|