C11H13ClN2S — CID 5078182
1-[(2-chlorophenyl)methyl]-3-prop-2-enylthiourea (PubChem CID 5078182) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 5078182 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCc1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN2S/c1-2-7-13-11(15)14-8-9-5-3-4-6-10(9)12/h2-6H,1,7-8H2,(H2,13,14,15) |
| InChIKey | RTEFUWKYJNUSCD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|