C12H14ClNOS — CID 78786831
2-[(2-chlorophenyl)methylsulfanyl]-N-prop-2-enylacetamide (PubChem CID 78786831) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 78786831 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNOS/c1-2-7-14-12(15)9-16-8-10-5-3-4-6-11(10)13/h2-6H,1,7-9H2,(H,14,15) |
| InChIKey | QSBPGHYKTWZPNT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|