C17H24ClNOS2 — CID 126033785
2-[(2-chlorophenyl)methylsulfanyl]-N-(2-cyclohexylsulfanylethyl)acetamide (PubChem CID 126033785) has the molecular formula C17H24ClNOS2 and a molecular weight of 357.97 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-(2-cyclohexylsulfanylethyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2-cyclohexylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 126033785 |
| Molecular Formula | C17H24ClNOS2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2-cyclohexylsulfanylethyl)acetamide |
| SMILES | O=C(CSCc1ccccc1Cl)NCCSC1CCCCC1 |
| InChI | InChI=1S/C17H24ClNOS2/c18-16-9-5-4-6-14(16)12-21-13-17(20)19-10-11-22-15-7-2-1-3-8-15/h4-6,9,15H,1-3,7-8,10-13H2,(H,19,20) |
| InChIKey | GRTYOQAMVLRCES-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|