C17H23Cl2NOS — CID 100594412
N-(2-cyclohexylsulfanylethyl)-3-(3,4-dichlorophenyl)propanamide (PubChem CID 100594412) has the molecular formula C17H23Cl2NOS and a molecular weight of 360.35 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-3-(3,4-dichlorophenyl)propanamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-3-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100594412 |
| Molecular Formula | C17H23Cl2NOS |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-3-(3,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)c(Cl)c1)NCCSC1CCCCC1 |
| InChI | InChI=1S/C17H23Cl2NOS/c18-15-8-6-13(12-16(15)19)7-9-17(21)20-10-11-22-14-4-2-1-3-5-14/h6,8,12,14H,1-5,7,9-11H2,(H,20,21) |
| InChIKey | LZKASKYNPCVTJD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|