C17H23NO3S — CID 94101635
3-(1,3-benzodioxol-5-yl)-N-(2-cyclopentylsulfanylethyl)propanamide (PubChem CID 94101635) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(2-cyclopentylsulfanylethyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(2-cyclopentylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 94101635 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(2-cyclopentylsulfanylethyl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NCCSC1CCCC1 |
| InChI | InChI=1S/C17H23NO3S/c19-17(18-9-10-22-14-3-1-2-4-14)8-6-13-5-7-15-16(11-13)21-12-20-15/h5,7,11,14H,1-4,6,8-10,12H2,(H,18,19) |
| InChIKey | AJUQSDQKGOYYLZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|