C19H26N2O4 — CID 46521646
3-(1,3-benzodioxol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]propanamide (PubChem CID 46521646) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 46521646 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[3-(2-oxoazepan-1-yl)propyl]propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C19H26N2O4/c22-18(9-7-15-6-8-16-17(13-15)25-14-24-16)20-10-4-12-21-11-3-1-2-5-19(21)23/h6,8,13H,1-5,7,9-12,14H2,(H,20,22) |
| InChIKey | HYNVYYNNOJJDOV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|