C21H32N2O3 — CID 69223994
1-[4-[[4-(1,3-benzodioxol-5-yl)-3-methylbutan-2-yl]amino]butyl]piperidin-2-one (PubChem CID 69223994) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[4-[[4-(1,3-benzodioxol-5-yl)-3-methylbutan-2-yl]amino]butyl]piperidin-2-one.
| Compound Name | 1-[4-[[4-(1,3-benzodioxol-5-yl)-3-methylbutan-2-yl]amino]butyl]piperidin-2-one |
|---|---|
| PubChem CID | 69223994 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-[4-[[4-(1,3-benzodioxol-5-yl)-3-methylbutan-2-yl]amino]butyl]piperidin-2-one |
| SMILES | CC(Cc1ccc2c(c1)OCO2)C(C)NCCCCN1CCCCC1=O |
| InChI | InChI=1S/C21H32N2O3/c1-16(13-18-8-9-19-20(14-18)26-15-25-19)17(2)22-10-4-6-12-23-11-5-3-7-21(23)24/h8-9,14,16-17,22H,3-7,10-13,15H2,1-2H3 |
| InChIKey | PBBYVFYWCRJETR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|